| Identification | |
| Name: | Phosphorous acid,tris(1-methylethyl) ester |
| Synonyms: | Isopropylphosphite ((C3H7O)3P) (6CI,7CI);Phosphorous acid, triisopropyl ester (8CI);Isopropyl phosphite;NSC 6516;Tri-2-propyl phosphite;Triisopropoxyphosphine; |
| CAS: | 116-17-6 |
| EINECS: | 204-130-0 |
| Molecular Formula: | C9H21O3P |
| Molecular Weight: | 208.24 |
| InChI: | InChI=1/C9H21O3P/c1-7(2)10-13(11-8(3)4)12-9(5)6/h7-9H,1-6H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3278 |
| Density: | 0.844 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4095-1.4115 |
| Water Solubility: | Insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colorless Clear Liquid |
| Specification: | clear to slightly turbid colorless liquid Safety Statements:37-46-45-36/37 37:Wear suitable gloves 46:If swallowed, seek medical advice immediately and show this container or label 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless liquid |
| Usage: | Intermediate for insecticides, component of vinyl stabilizers, lubricant additive, specialty solvent. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
