Identification |
Name: | Phosphorous acid,tris(2-methylphenyl) ester |
Synonyms: | Phosphorousacid, tri-o-tolyl ester (8CI); o-Tolyl phosphite ((C7H7O)3P) (7CI); o-Tolylphosphite (6CI); Tri-o-cresyl phosphite; Tri-o-tolyl phosphite;Tris(2-methylphenyl) phosphite; Tris(o-methylphenyl) phosphite;Tris(o-tolyloxy)phosphine |
CAS: | 2622-08-4 |
EINECS: | 220-068-7 |
Molecular Formula: | C21H21 O3 P |
Molecular Weight: | 352.3679 |
InChI: | InChI=1/C21H21O3P/c1-16-10-4-7-13-19(16)22-25(23-20-14-8-5-11-17(20)2)24-21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 250.5°C |
Boiling Point: | 410.8°Cat760mmHg |
Density: | g/cm3 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 250.5°C |
Storage Temperature: | Refrigerator |
Sensitive: | Moisture Sensitive |
Safety Data |
|
 |