| Identification |
| Name: | 2,6-Dichlorotoluene |
| Synonyms: | Benzene, 1,3-dichloro-2-methyl-; 2,6-DCT |
| CAS: | 118-69-4 |
| EINECS: | 204-269-7 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.254 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.55-1.552 |
| Solubility: | 24 mg/L (20 ºC) |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Chemical intermediate for dyes, high boiling solvent. |
| Safety Data |
| Hazard Symbols |
T:Toxic
Xi:Irritant
|
| |
 |
