| Identification |
| Name: | 3,4-Dichlorotoluene |
| Synonyms: | 3,4-DCT; Benzene, 1,2-dichloro-4-methyl-; |
| CAS: | 95-75-0 |
| EINECS: | 202-447-9 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 1.253 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.546-1.548 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | colorless clear liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
