| Identification | |
| Name: | Acetic-d3 acid-d |
| Synonyms: | acetic acid 99.5 atom % D; Acetic acid-d4; ACETIC ACID |
| CAS: | 1186-52-3 |
| EINECS: | 214-693-4 |
| Molecular Formula: | [2H]4C2O2 |
| Molecular Weight: | 64.07 |
| InChI: | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| Molecular Structure: | ![([2H]4C2O2) acetic acid 99.5 atom % D; Acetic acid-d4; ACETIC ACID](https://img.guidechem.com/casimg/1186-52-3.gif) |
| Properties | |
| Transport: | UN 2789 8/PG 2 |
| Density: | 1.13 |
| Stability: | Stable. Incompatible with acids, bases, oxidizing agents, carbonates and phosphates, hydroxides, metals, oxides, acid anhydrides, peroxides, permanganates, amines, alcohols. Protect from moisture. Flammable. |
| Refractive index: | n20/D 1.368(lit.) |
| Solubility: | blending with water, ethanol and aether |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
