| Identification |
| Name: | Methanamine,1,1-diethoxy-N,N-dimethyl- |
| Synonyms: | Trimethylamine,1,1-diethoxy- (6CI,7CI,8CI);1,1-Diethoxy-N,N-dimethylmethanamine;DMF di-Etacetal;DMF diethyl acetal;Dimethylformamide diethyl acetal;Formamide,N,N-dimethyl-, diethyl acetal;NSC 377652; |
| CAS: | 1188-33-6 |
| EINECS: | 214-707-9 |
| Molecular Formula: | C7H17NO2 |
| Molecular Weight: | 147.22 |
| InChI: | InChI=1/C7H17NO2/c1-5-9-7(8(3)4)10-6-2/h7H,5-6H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 0.859 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.411(lit.) |
| Solubility: | Slightly soluble |
| Appearance: | Clear light yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29225000 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
