| Identification | |
| Name: | Benzenemethanol,4-(dimethylamino)-a-[4-(dimethylamino)phenyl]- |
| Synonyms: | Benzhydrol,4,4'-bis(dimethylamino)- (6CI,7CI,8CI);Benzohydrol, 4,4'-bis(dimethylamino)-(4CI);Michler's hydrol;N,N'-Tetramethyl-4,4'-diaminobenzohydrol;NSC 3563;Tetramethyldiaminobenzhydrol;p,p'-Bis(dimethylamino)benzhydrol;a,a-Bis(p-dimethylaminophenyl)methanol; |
| CAS: | 119-58-4 |
| EINECS: | 204-335-5 |
| Molecular Formula: | C17H22N2O |
| Molecular Weight: | 270.41 |
| InChI: | InChI=1/C17H22N2O/c1-18(2)15-9-5-13(6-10-15)17(20)14-7-11-16(12-8-14)19(3)4/h5-12,17,20H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98-105 ºC |
| Flash Point: | 228.7°C |
| Boiling Point: | 446.3°Cat760mmHg |
| Density: | 1.112g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.623 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | Gray to brown crystals. |
| Specification: | SLIGHTLY YELLOW TO BROWNISH CRYSTALLINE POWDER Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 228.7°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Dye intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
