| Identification | |
| Name: | Benzenemethanol,4-(dimethylamino)- |
| Synonyms: | Benzylalcohol, p-(dimethylamino)- (6CI,7CI,8CI);4-(Hydroxymethyl)-N,N-dimethylaniline; 4-(N,N-Dimethylamino)benzyl alcohol; 4-Dimethylaminobenzylalcohol; NSC 49744; p-(Dimethylamino)benzyl alcohol |
| CAS: | 1703-46-4 |
| Molecular Formula: | C9H13 N O |
| Molecular Weight: | 151.21 |
| InChI: | InChI=1/C9H13NO/c1-10(2)9-5-3-8(7-11)4-6-9/h3-6,11H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 138.1°C |
| Density: | 1.07 |
| Refractive index: | 1.58 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 138.1°C |
| Storage Temperature: | Freezer |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
