Identification |
Name: | Benzenemethanol,4-(dimethylamino)- |
Synonyms: | Benzylalcohol, p-(dimethylamino)- (6CI,7CI,8CI);4-(Hydroxymethyl)-N,N-dimethylaniline; 4-(N,N-Dimethylamino)benzyl alcohol; 4-Dimethylaminobenzylalcohol; NSC 49744; p-(Dimethylamino)benzyl alcohol |
CAS: | 1703-46-4 |
Molecular Formula: | C9H13 N O |
Molecular Weight: | 151.21 |
InChI: | InChI=1/C9H13NO/c1-10(2)9-5-3-8(7-11)4-6-9/h3-6,11H,7H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 138.1°C |
Density: | 1.07 |
Refractive index: | 1.58 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 138.1°C |
Storage Temperature: | Freezer |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |