| Identification | |
| Name: | Benzophenone |
| Synonyms: | Diphenyl ketone; Diphenylmethanone; melting point standard benzophenone; dipheneyl ketone; alpha-Oxodiphenylmethane; alpha-Oxoditane; Benzoylbenzene; Oxodiphenylmethane; Oxoditane; phenyl ketone; Benzophenones; Photoinitiator-BP |
| CAS: | 119-61-9 |
| EINECS: | 204-337-6 |
| Molecular Formula: | C13H10O |
| Molecular Weight: | 182.22 |
| InChI: | InChI=1/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.11 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. Combustible. |
| Refractive index: | 1.5893 |
| Water Solubility: | insoluble ( |
| Solubility: | insoluble (<0.1 g/100 mL at 25 oC) |
| Appearance: | Orange Crystals |
| Specification: |
? Benzophenone , with CAS number of 119-61-9, can be called Benzene, benzoyl- ; Diphenylmethanone ; alpha-Oxodiphenylmethane ; alpha-Oxoditane ; Methanone, diphenyl- ; Ketone, diphenyl .?It can be used as a photo initiator in UV-curing applications such as inks, imaging, and clear coatings in the printing industry. |
| Packinggroup: | III |
| HS Code: | 29143900 |
| Storage Temperature: | Store in a tightly closed container. Keep from contact with oxidizing materials. Store in a cool, dry area away from incompatible substances. |
| Color: | Orthorhombic bisphenoidal prisms from alcohol or ether Rhombic prisms (stable form), monoclinic prisms (labile form), white crystals |
| Usage: | Reported to bind monsaccharides in the presence of polysaccharides |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
