| Identification | |
| Name: | Benzophenone oxime |
| Synonyms: | Diphenylketone oxime |
| CAS: | 574-66-3 |
| EINECS: | 209-373-6 |
| Molecular Formula: | C13H11NO |
| Molecular Weight: | 197.24 |
| InChI: | InChI=1/C13H11NO/c15-14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 209.8°C |
| Density: | 1.05g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.569 |
| Water Solubility: | insoluble |
| Solubility: | 83 mg/l AUTOIGNITION |
| Appearance: | white crystals |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 209.8°C |
| Storage Temperature: | 0-6°C |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
