| Identification | |
| Name: | 4-fluorobenzonitrile |
| Synonyms: | p-Fluorobenzonitrile; PFBN; 4-fluoro-benzonitril; Benzonitrile, p-fluoro-; p-Cyanofluorobenzene; p-fluoro-benzonitril; P-Fluorobenzonitile |
| CAS: | 1194-02-1 |
| EINECS: | 214-784-9 |
| Molecular Formula: | C7H4FN |
| Molecular Weight: | 121.11 |
| InChI: | InChI=1/C7H4FN/c8-7-3-1-6(5-9)2-4-7/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | 1.15 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4925 (55 C) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to white semi solid |
| Specification: |
?4-Fluorobenzonitrile (CAS NO.1194-02-1), its Synonyms are p-Cyanofluorobenzene ; p-Fluorobenzonitrile ; Benzonitrile, 4-fluoro- ; Benzonitrile, p-fluoro- . It is white crystalline low melting solid. |
| Report: |
On Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
