| Identification | |
| Name: | 2-Amino-4-fluorobenzonitrile |
| Synonyms: | CHEMBL1082237;CHEBI:715547;CID11779266;N-[6-(4-oxo-1-cyclohexa-2,5-dienylidene)-1,2-dihydroindazol-3-yl]butanamide;4-Fluoroanthranilonitrile;Benzonitrile, 2-amino-4-fluoro-;2-Amino-4-fluorobenzonitrile 98%; |
| CAS: | 80517-22-2 |
| Molecular Formula: | C7H5FN2 |
| Molecular Weight: | 136.13 |
| InChI: | InChI=1/C7H5FN2/c8-6-2-1-5(4-9)7(10)3-6/h1-3H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.256 g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
The 2-Amino-4-fluorobenzonitrile, with CAS registry number 80517-22-2, belongs to the following product categorie: Phenyls & Phenyl-Het. It has the systematic name of 2-amino-4-fluorobenzonitrile. Besides this, it is also called Benzonitrile, 2-amino-4-fluoro-. And the chemical formula of this chemical is C7H5FN2. Physical properties about this chemical are: (1)ACD/LogP: 1.43; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 15; (6)ACD/BCF (pH 7.4): 15; (7)ACD/KOC (pH 5.5): 240; (8)ACD/KOC (pH 7.4): 240; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 49.81 Å2; (13)Index of Refraction: 1.56; (14)Molar Refractivity: 35.05 cm3; (15)Molar Volume: 108.37 cm3; (16)Polarizability: 13.895×10-24cm3; (17)Surface Tension: 50.105 dyne/cm; (18)Enthalpy of Vaporization: 52.367 kJ/mol; (19)Vapour Pressure: 0.003 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
