| Identification |
| Name: | 4-methyl-2-aminoanisole |
| Synonyms: | 5-Methyl-o-Anisidine; azoic red; C.I. azoic red 83; Cresidine; krezidine; 2-Methoxy-5-methylaniline |
| CAS: | 120-71-8 |
| EINECS: | 204-419-1 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 1.368g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.549 |
| Water Solubility: | Slightly soluble in hot water. |
| Solubility: | Insoluble (soluble in most common organic solvents) AUTOIGN |
| Appearance: | yellow to brown crystalline solid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | White crystals |
| Usage: | Used to create dyes and pigments. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
