| Identification | |
| Name: | 1,2,4-Trichlorobenzene |
| Synonyms: | 1,2,4-trichlorobenzol; 1,2,5-Trichlorobenzene; 1,3,4-Trichlorobenzene; hostetex L-pec; TRICHLOROBENZENE124-,,; Trichlorobenzene, 1,2,4-? Trichlorobenzol; Unsym-trichlorobenzene |
| CAS: | 120-82-1 |
| EINECS: | 204-428-0 |
| Molecular Formula: | C6H3Cl3 |
| Molecular Weight: | 181.45 |
| InChI: | InChI=1/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2321 |
| Density: | 1.45 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.57-1.572 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble. 0.0049 g/100ml AUTOIGNITION |
| Appearance: | colorless liquid with a pleasant odor. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Color: | Colorless liquid Orthorhombic crystals Colorless liquid or crystalline solid (below 63 degrees F). |
| Usage: | Solvent in chemical manufacturing, dyes & intermediates, dielectric fluid, synthetic transformer oils, lubricants, heat-transfer medium, insecticides. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
