Identification |
Name: | 1,2,4-Trichlorobenzene |
Synonyms: | 1,2,4-trichlorobenzol; 1,2,5-Trichlorobenzene; 1,3,4-Trichlorobenzene; hostetex L-pec; TRICHLOROBENZENE124-,,; Trichlorobenzene, 1,2,4-? Trichlorobenzol; Unsym-trichlorobenzene |
CAS: | 120-82-1 |
EINECS: | 204-428-0 |
Molecular Formula: | C6H3Cl3 |
Molecular Weight: | 181.45 |
InChI: | InChI=1/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
Molecular Structure: |
 |
Properties |
Transport: | UN 2321 |
Density: | 1.45 |
Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
Refractive index: | 1.57-1.572 |
Water Solubility: | INSOLUBLE |
Solubility: | Insoluble. 0.0049 g/100ml AUTOIGNITION |
Appearance: | colorless liquid with a pleasant odor. |
Packinggroup: | III |
HS Code: | 29036990 |
Color: | Colorless liquid Orthorhombic crystals Colorless liquid or crystalline solid (below 63 degrees F). |
Usage: | Solvent in chemical manufacturing, dyes & intermediates, dielectric fluid, synthetic transformer oils, lubricants, heat-transfer medium, insecticides. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |