Identification |
Name: | Propanoic acid,3-[[(R)-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl][[3-(dimethylamino)-3-oxopropyl]thio]methyl]thio]- |
Synonyms: | Propanoicacid, 3-[[[3-[2-(7-chloro-2-quinolinyl)ethenyl]phenyl][[3-(dimethylamino)-3-oxopropyl]thio]methyl]thio]-,[R-(E)]-; L 668019; MK 679; R-(-)-MK 571; Verlukast |
CAS: | 120443-16-5 |
Molecular Formula: | C26H27 Cl N2 O3 S2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C26H27ClN2O3S2/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32)/b10-6+ |
Molecular Structure: |
|
Properties |
Flash Point: | 384.6°C |
Boiling Point: | 712.3°Cat760mmHg |
Density: | 1.327g/cm3 |
Flash Point: | 384.6°C |
Usage: | A receptor antagonist for the treatment of respiratory diseases |
Safety Data |
|
|