| Identification | |
| Name: | 1-Propanone,1-(4-methoxyphenyl)- |
| Synonyms: | p-Methoxypropiophenone;4-Methoxypropiophenone;Propiophenone,4'-methoxy- (6CI,7CI,8CI);Propiophenone, p-methoxy- (4CI);1-(4-Methoxyphenyl)-1-propanone;1-Methoxy-4-propanoylbenzene;4-Propanoylanisole;4'-Methoxypropiophenone;Ethyl 4-methoxyphenyl ketone;Ethyl p-methoxyphenyl ketone;NSC 11834; |
| CAS: | 121-97-1 |
| EINECS: | 204-512-7 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 1.071 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5465 |
| Appearance: | white crystal |
| Specification: | CLEAR COLOURLESS TO AMBER LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
