| Identification | |
| Name: | Acetamide,N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]- |
| Synonyms: | Acetamide,N-[2-(5-hydroxyindol-3-yl)ethyl]- (6CI,7CI,8CI);5-Hydroxy-N-acetyltryptamine;5-Hydroxymelatonin;N-(2-(5-Hydroxy-1H-indol-3-yl)ethyl)acetamide;N-Acetyl-2-(5-hydroxyindol-3-yl)ethylamine;N-Acetyl-5-hydroxytryptamine;N-Acetylserotonin;Normelatonin;O-Demethylmelatonin;Serotonin, N-acetyl-; |
| CAS: | 1210-83-9 |
| EINECS: | 214-916-5 |
| Molecular Formula: | C12H14N2O2 |
| Molecular Weight: | 218.25176 |
| InChI: | InChI=1S/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
| Molecular Structure: | ![(C12H14N2O2) Acetamide,N-[2-(5-hydroxyindol-3-yl)ethyl]- (6CI,7CI,8CI);5-Hydroxy-N-acetyltryptamine;5-Hydroxymela...](https://img1.guidechem.com/chem/e/dict/39/1210-83-9.jpg) |
| Properties | |
| Flash Point: | 214-916-5 |
| Density: | 1.268 g/cm3 |
| Refractive index: | 1.651 |
| Water Solubility: | ethanol: 50 mg/mL |
| Solubility: | ethanol: 50 mg/mL |
| Appearance: | White to off-white or slightly pink powder |
| Specification: |
Acetamide,N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]- (CAS No.1210-83-9), it also can be called 5-Hydroxy-N-acetyltryptamine ; N-[2-(5-Hydroxy-1H-indol-3-yl)ethyl]acetamid .It should be avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.And it should be stored in a tightly closed container. Store in a dry area. Keep refrigerated. |
| Flash Point: | 214-916-5 |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | A metabolite of Melatonin (M215000). |
| Safety Data | |
 |
|
