Identification |
Name: | Acetamide,N-[2-(6-hydroxy-5-methoxy-1H-indol-3-yl)ethyl]- |
Synonyms: | Acetamide,N-[2-(6-hydroxy-5-methoxyindol-3-yl)ethyl]- (6CI,7CI,8CI);6-Hydroxy-N-acetyl-5-methoxytryptamine; 6-Hydroxymelatonin |
CAS: | 2208-41-5 |
Molecular Formula: | C13H16 N2 O3 |
Molecular Weight: | 248.28 |
InChI: | InChI=1/C13H16N2O3/c1-8(16)14-4-3-9-7-15-11-6-12(17)13(18-2)5-10(9)11/h5-7,15,17H,3-4H2,1-2H3,(H,14,16) |
Molecular Structure: |
|
Properties |
Flash Point: | 295.3°C |
Boiling Point: | 564.7°Cat760mmHg |
Density: | 1.266g/cm3 |
Refractive index: | 1.627 |
Specification: | Off-White to Pale Beige Solid usageEng:A major human metabolite of Melatonin Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
Flash Point: | 295.3°C |
Storage Temperature: | Refrigerator |
Usage: | A major human metabolite of Melatonin |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|