| Identification |
| Name: | Acetamide,N-[2-(2-iodo-5-methoxy-1H-indol-3-yl)ethyl]- |
| Synonyms: | 2-Iodomelatonin;N-Acetyl-2-iodo-5-methoxytryptamine |
| CAS: | 93515-00-5 |
| Molecular Formula: | C13H15 I N2 O2 |
| Molecular Weight: | 358.17 |
| InChI: | InChI=1/C13H15IN2O2/c1-8(17)15-6-5-10-11-7-9(18-2)3-4-12(11)16-13(10)14/h3-4,7,16H,5-6H2,1-2H3,(H,15,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 301.3°C |
| Boiling Point: | 574.5°Cat760mmHg |
| Density: | 1.63g/cm3 |
| Refractive index: | 1.654 |
| Biological Activity: | Potent melatonin agonist (pK i values are 10.55 and 9.87 at human recombinant MT 1 and MT 2 receptors respectively). 2-[ 125 I]-iodomelatonin has been used to identify, characterize and localize melatonin binding sites in the brain and peripheral tissues. |
| Flash Point: | 301.3°C |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
