Identification |
Name: | Acetamide,N-[2-(5-methoxy-2-phenyl-1H-indol-3-yl)ethyl]- |
Synonyms: | 2-Phenylmelatonin;N-Acetyl-5-methoxy-2-phenyltryptamine; UCM 608 |
CAS: | 151889-03-1 |
Molecular Formula: | C19H20 N2 O2 |
Molecular Weight: | 308.37 |
InChI: | InChI=1/C19H20N2O2/c1-13(22)20-11-10-16-17-12-15(23-2)8-9-18(17)21-19(16)14-6-4-3-5-7-14/h3-9,12,21H,10-11H2,1-2H3,(H,20,22) |
Molecular Structure: |
|
Properties |
Flash Point: | 324.2°C |
Boiling Point: | 612.4°C at 760 mmHg |
Density: | 1.172g/cm3 |
Refractive index: | 1.619 |
Biological Activity: | Highly potent melatonin agonist; displays higher affinity and greater potency than melatonin itself. The EC 50 values for G protein activation in MT 1 and MT 2 -transfected cells are 65 and 58 pM respectively. |
Flash Point: | 324.2°C |
Safety Data |
|
|