Identification |
Name: | a-D-Mannopyranose, O-a-D-mannopyranosyl-(1®3)-O-[a-D-mannopyranosyl-(1®6)]- |
CAS: | 121123-33-9 |
Molecular Formula: | C18H32 O16 |
Molecular Weight: | 504.44 |
InChI: | InChI=1/C18H32O16/c19-1-4-7(21)10(24)12(26)17(32-4)30-3-6-9(23)15(14(28)16(29)31-6)34-18-13(27)11(25)8(22)5(2-20)33-18/h4-29H,1-3H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 485.6°C |
Boiling Point: | 879.4°C at 760 mmHg |
Density: | 1.8g/cm3 |
Refractive index: | 1.673 |
Flash Point: | 485.6°C |
Storage Temperature: | −20°C |
Usage: | Mannotriose core structure of n-linked oligosaccharides. Of potential interest in the development of conjugated vaccine. |
Safety Data |
|
|