Identification |
Name: | a-D-Mannopyranoside, methyl O-a-D-mannopyranosyl-(1®3)-O-[a-D-mannopyranosyl-(1®6)]- |
Synonyms: | Methyl3,6DiO(aDMannopyranosyl)aDMannopyranoside;a1,3a1,6Mannotriose,aMethylGlycoside |
CAS: | 68601-74-1 |
Molecular Formula: | C19H34 O16 |
Molecular Weight: | 518.46 |
InChI: | InChI=1/C19H34O16/c1-30-17-15(29)16(35-19-14(28)12(26)9(23)6(3-21)33-19)10(24)7(34-17)4-31-18-13(27)11(25)8(22)5(2-20)32-18/h5-29H,2-4H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 474.8°C |
Boiling Point: | 861.5°C at 760 mmHg |
Density: | 1.7g/cm3 |
Refractive index: | 1.64 |
Flash Point: | 474.8°C |
Usage: | Has been shown to be a very good inhibitor of the binding of phage G13 to its native receptor in the core region of lipopolsaccharides from Salmonella bacteria |
Safety Data |
|
|