| Identification | |
| Name: | Acetamide,N-[4-[bis(2-chloroethyl)amino]phenyl]- |
| Synonyms: | Acetanilide,4'-[bis(2-chloroethyl)amino]- (6CI,7CI,8CI); Lonin 3 |
| CAS: | 1215-16-3 |
| Molecular Formula: | C12H16 Cl2 N2 O |
| Molecular Weight: | 275.20 |
| InChI: | InChI=1/C12H16Cl2N2O/c1-10(17)15-11-2-4-12(5-3-11)16(8-6-13)9-7-14/h2-5H,6-9H2,1H3,(H,15,17) |
| Molecular Structure: | ![(C12H16Cl2N2O) Acetanilide,4'-[bis(2-chloroethyl)amino]- (6CI,7CI,8CI); Lonin 3](https://img1.guidechem.com/chem/e/dict/39/1215-16-3.jpg) |
| Properties | |
| Flash Point: | 237.8°C |
| Boiling Point: | 469.5°Cat760mmHg |
| Density: | 1.272g/cm3 |
| Refractive index: | 1.598 |
| Specification: |
4'-(Bis(2-chloroethyl)amino)acetanilide , its cas register number is 1215-16-3. It also can be called N-(4-(Bis(2-chloroethyl)amino)phenyl)acetamide ; N-(p-Acetyl-amino-phenyl)-2,2'-dichlorodiethylamine ; p-Acetylaminophenyl derivative of nitrogen mustard ; and Acetyl-N-(p-aminophenyl)-nitrogen mustard . |
| Flash Point: | 237.8°C |
| Safety Data | |
 |
|
