| Identification | |
| Name: | Acetamide,N-[4-[bis(2-chloroethyl)amino]phenyl]-2-fluoro- |
| Synonyms: | Acetanilide,4'-[bis(2-chloroethyl)amino]-2-fluoro- (6CI,7CI,8CI); NSC 240362 |
| CAS: | 1492-93-9 |
| Molecular Formula: | C12H15 Cl2 F N2 O |
| Molecular Weight: | 293.19 |
| InChI: | InChI=1/C12H15Cl2FN2O/c13-5-7-17(8-6-14)11-3-1-10(2-4-11)16-12(18)9-15/h1-4H,5-9H2,(H,16,18) |
| Molecular Structure: | ![(C12H15Cl2FN2O) Acetanilide,4'-[bis(2-chloroethyl)amino]-2-fluoro- (6CI,7CI,8CI); NSC 240362](https://img1.guidechem.com/chem/e/dict/35/1492-93-9.jpg) |
| Properties | |
| Flash Point: | 242.8°C |
| Boiling Point: | 477.9°C at 760 mmHg |
| Density: | 1.322g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
4'-(Bis(2-chloroethyl)amino)-2-fluoroacetanidide , its cas register number is 1492-93-9. It also can be called N-(p-(alpha-Fluoroacetylamino)phenyl)-2,2'-dichlorodiethylamine ; p-Fluoroacetylaminophenyl derivative of nitrogen mustard ; Fluoroacetyl-N-(p-aminophenyl)-nitrogen mustard ; and 4'-(Bis(2-chloroethyl)amino)-2-fluoroacetanilide . |
| Flash Point: | 242.8°C |
| Safety Data | |
 |
|
