| Identification | |
| Name: | Phenoxyacetic acid |
| Synonyms: | phenoxyethanoic acid; Glycolic acid phenyl ether; o-Phenylglycolic acid |
| CAS: | 122-59-8 |
| EINECS: | 204-556-7 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 285 |
| Stability: | Stable. Substances to be avoided include strong bases, strong oxidizing agents. Combustible. |
| Solubility: | soluble (soluble in ether, carbon disulfide, methanol, and acetic acid) |
| Appearance: | off white crystalline powder |
| Specification: | off-white powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | Z01 |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Usage: | Used to kill fungus. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
