| Identification | |
| Name: | 4-Chlorophenoxyacetic acid |
| Synonyms: | 4-Chlorophenoxyacetic Acid(4-Cpa);Aceticacid, (4-chlorophenoxy)- (9CI);Acetic acid, (p-chlorophenoxy)- (8CI);(4-Chlorophenoxy)acetic acid;(p-Chlorophenoxy)acetic acid;4-CP;4-CPA;BI 12;HP 55;NSC 8769;NSC 9213;PCPA;Tomatone;Tomatotone;p-CPA;Aceticacid, 2-(4-chlorophenoxy)-; |
| CAS: | 122-88-3 |
| EINECS: | 204-581-3 |
| Molecular Formula: | C8H7ClO3 |
| Molecular Weight: | 186.59 |
| InChI: | InChI=1/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.366 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Slightly soluble in water |
| Solubility: | Slightly soluble in water |
| Appearance: | white to light beige powder |
| Specification: |
?4-Chlorophenoxyacetic acid (CAS NO.122-88-3) is also named as (4-Chlorophenoxy)acetic acid ; 4-06-00-00845 (Beilstein Handbook Reference) ; 4-CP ; 4-CPA ;?4CPA ; AI3-30799 ; Acetic acid, (4-chlorophenoxy)- ; Acetic acid, (p-chlorophenoxy)- ; BI 12 ; BRN 1211804 ; CCRIS 1465 ; CPA ; Caswell No. 204 ; EPA Pesticide Chemical Code 019401 ; HSDB 3944 ; Kyselina 4-chlorfenoxyoctova ; Kyselina 4-chlorfenoxyoctova [Czech] ; Marks 4-cpa ; PCPA ; Parachlorophenoxyacetic acid ; Sure-Set ; Tomato Fix ; Tomato Fix concentrate ; Tomato hold ; Tomatotone ; p-Chlorophenoxyacetic acid .?4-Chlorophenoxyacetic acid (CAS NO.122-88-3) is white to light beige powder with a clear flavor. It is soluble in alcohol, acetone and benzene, slightly soluble in water. It is?toxic and flammable. It will produce toxic?chlorine gas when buring. So the storage environment should be ventilate, low-temperature and dry. Keep?4-Chlorophenoxyacetic acid (CAS NO.122-88-3) separate from raw materials of food. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29189090 |
| Color: | Prisms or needles from water |
| Usage: | Plant growth regulator. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
