| Identification | |
| Name: | 3-Chlorophenoxyacetic acid |
| Synonyms: | m-Chlorophenoxyacetic acid |
| CAS: | 588-32-9 |
| EINECS: | 209-616-6 |
| Molecular Formula: | C8H7ClO3 |
| Molecular Weight: | 186.59 |
| InChI: | InChI=1/C8H7ClO3/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.366 g/cm3 |
| Solubility: | Slightly soluble in chloroform. Soluble in ethanol and ether. Very soluble in benzene Slightly soluble in water |
| Appearance: | white crystal |
| Specification: |
It should avoid incompatible materials such as strong Oxidizing agents and it should avoid dust generation .Its hazardous decomposition products is Hydrogen chloride , Carbon monoxide, Carbon dioxide . |
| Packinggroup: | III |
| Color: | Crystals from water |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
