| Identification | |
| Name: | Sodium Aurothiomalate |
| Synonyms: | sodium aurothiomalate hydrate; disodium 2-(auriothio)succinate; Gold sodium Thiomalate |
| CAS: | 12244-57-4 |
| EINECS: | 235-479-7 |
| Molecular Formula: | C4H3AuNa2O4S |
| Molecular Weight: | 390.07 |
| InChI: | InChI=1/C4H6O4S.Au.2Na/c5-3(6)1-2(9)4(7)8;;;/h2,9H,1H2,(H,5,6)(H,7,8);;;/q;3*+1/p-3/rC4H5AuO4S.2Na/c5-10-2(4(8)9)1-3(6)7;;/h2H,1H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Solubility: | Very soluble in water; practically insoluble in alcohol, ether |
| Specification: |
Disodium ; gold(1+) ; 2-sulfidobutanedioate with CAS number of 12244-57-4 is also known as ((1,2-Dicarboxyethyl)thio)golddisodiumsalt ; ((1,2-Dicarboxyethyl)thio)-goldisodiumsalt ; (dihydrogenmercaptosuccinato)golddisodiumsalt ; (Mercaptobutanedioato(1-))golddisodiumsalt ; Aurothiomaleatesodium ; Autm ; chrysothios ; disodiumaurothiomalate . It can be used for anti-inflammatory analgesic . |
| Color: | White to yellowish-white powder; mixture of mono- and disodium salts |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
