| Identification | |
| Name: | Benzene,1,3-diisocyanato- |
| Synonyms: | Isocyanicacid, m-phenylene ester (6CI,7CI,8CI); 1,3-Diisocyanatobenzene; 1,3-Phenylenediisocyanate; Benzene 1,3-diisocyanate; NSC 511721; Nacconate 400; m-Phenylenediisocyanate; m-Phenylene isocyanate |
| CAS: | 123-61-5 |
| EINECS: | 204-637-7 |
| Molecular Formula: | C8H4 N2 O2 |
| Molecular Weight: | 160.1296 |
| InChI: | InChI=1S/C8H4N2O2/c11-5-9-7-2-1-3-8(4-7)10-6-12/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6.1/PG 3 |
| Melting Point: | 49-51 °C(lit.) |
| Flash Point: | >230 °F |
| Boiling Point: | 121 °C25 mm Hg(lit.) |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.567 |
| Specification: | White to off-white fused solid Safety Statements:22-26-36/37 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | II |
| Flash Point: | >230 °F |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
