| Identification | |
| Name: | Nonanedioyl dichloride |
| Synonyms: | Azelaoylchloride (6CI,7CI,8CI);Azelaic acid chloride;Azelaic acid dichloride;Azelaoyl acid dichloride;Azelaoyl dichloride;Nonanedioicdichloride;Nonanedioyl chloride; |
| CAS: | 123-98-8 |
| EINECS: | 204-668-6 |
| Molecular Formula: | C9H14Cl2O2 |
| Molecular Weight: | 225.11 |
| InChI: | InChI=1/C9H14Cl2O2/c10-8(12)6-4-2-1-3-5-7-9(11)13/h1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Flash Point: | 138.9°C |
| Boiling Point: | 291.5°Cat760mmHg |
| Density: | 1.159g/cm3 |
| Refractive index: | n20/D 1.467(lit.) |
| Appearance: | clear yellow-brown liquid |
| Specification: | CLEAR YELLOW-BROWN LIQUID Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 138.9°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
