| Identification | |
| Name: | Benzenediol |
| Synonyms: | Dihydroxybenzene |
| CAS: | 12385-08-9 |
| Molecular Formula: | C6H6 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105 deg C |
| Boiling Point: | 245.5 deg C at 760 mm Hg; sublimes |
| Solubility: | Sol in chloroform, ether; very sol in pyridine, ... aqueous alkalis. Slightly sol in cold benzene; sol in carbon tetrachloride, and hot benzene. Soluble in alcohol, ether, acetate In water, 4.61X10+5 mg/L at 25 deg C |
| Color: | Monoclinic tablets, prisms from toluene Colorless crystals, discolors to brown on exposure to air and light, especially when moist |
| Safety Data | |
 |
|
