| Identification | |
| Name: | Tetradecanoic acid,ethyl ester |
| Synonyms: | Myristicacid, ethyl ester (6CI,7CI,8CI);Ethyl tetradecanoate;NSC8917;Nikkol BM; |
| CAS: | 124-06-1 |
| EINECS: | 204-675-4 |
| Molecular Formula: | C16H32O2 |
| Molecular Weight: | 256.42 |
| InChI: | InChI=1/C16H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3-15H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.86 |
| Refractive index: | 1.436 |
| Water Solubility: | Slightly soluble in ether |
| Solubility: | Slightly soluble in ether |
| Appearance: | colorless to pale yellow clear liquid |
| Specification: | Clear colorless liquid, solidifying in the cold usageEng:A component from essential oil of natural hawthorn perfume. |
| Storage Temperature: | Refrigerator |
| Usage: | A component from essential oil of natural hawthorn perfume. |
| Safety Data | |
 |
|
