Identification |
Name: | Tetradecanoic acid,tetradecyl ester |
Synonyms: | Myristicacid, tetradecyl ester (7CI,8CI);1-Tetradecanol, myristate;Alkamuls MM/M;Ceraphyl 424;Cetiol MM;Crodamol MM;Cyclochem MM;Exceparl MY-M;Liponate MM;Tetradecyl myristate;Tetradecyl tetradecanoate; |
CAS: | 3234-85-3 |
EINECS: | 221-787-9 |
Molecular Formula: | C28H56O2 |
Molecular Weight: | 424.75 |
InChI: | InChI=1/C28H56O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-30-28(29)26-24-22-20-18-16-14-12-10-8-6-4-2/h3-27H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 37-44ºC |
Density: | 0.859 g/cm3 |
Refractive index: | 1.452 |
Appearance: | Waxy solid |
Specification: |
The extinguishing agent of Myristyl myristate (CAS NO.3234-85-3) are dry powder, foam, sand, carbon dioxide, water mist.
|
Safety Data |
|
 |