Identification |
Name: | L-Tyrosine,N-[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]- |
Synonyms: | L-Tyrosine,N-[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]- (9CI); L-Tyrosine,N-[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]-, (E)-; Angola I;Caffeoyl-N-tyrosine |
CAS: | 124027-56-1 |
Molecular Formula: | C18H17 N O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H17NO6/c20-13-5-1-11(2-6-13)9-14(18(24)25)19-17(23)8-4-12-3-7-15(21)16(22)10-12/h1-8,10,14,20-22H,9H2,(H,19,23)(H,24,25)/b8-4+ |
Molecular Structure: |
|
Properties |
Refractive index: | 1.697 |
Usage: | It was identified in the antioxidant polyphenolic fraction of cocoa (Theobroma cacao L.). As a naturally occurring caffeoyl conjugate, Clovamide derivative represents an interesting antiradical/antioxidant compound. |
Safety Data |
|
|