| Identification | |
| Name: | Valacyclovir hydrochloride |
| Synonyms: | L-Valine,2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester,monohydrochloride (9CI);L-Valine, ester with 9-((2-hydroxyethoxy)methyl)guanine,;Valacyclovir HCL; |
| CAS: | 124832-27-5 |
| Molecular Formula: | C13H21ClN6O4 |
| Molecular Weight: | 360.8 |
| InChI: | InChI=1/C13H20N6O4.ClH/c1-7(2)8(14)12(21)23-4-3-22-6-19-5-16-9-10(19)17-13(15)18-11(9)20;/h5,7-8H,3-4,6,14H2,1-2H3,(H3,15,17,18,20);1H/t8-;/m0./s1 |
| Molecular Structure: | ![(C13H21ClN6O4) L-Valine,2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester,monohydrochloride (9CI);L-V...](https://img.guidechem.com/casimg/124832-27-5.gif) |
| Properties | |
| Density: | 1.55g/cm3 |
| Refractive index: | 1.673 |
| Appearance: | White to off-white crystalline power |
| Usage: | The L-Valine ester prodrug of Acyclovir |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
