| Identification | |
| Name: | Antimonate(1-),[D-gluconato(4-)]-, sodium |
| Synonyms: | Gluconicacid, antimony sodium deriv. (6CI); D-Gluconic acid, antimony complex; Sodiumantimony gluconate; Sodium antimonylgluconate; Triostam; Triostib |
| CAS: | 12550-17-3 |
| EINECS: | 235-699-3 |
| Molecular Formula: | C6H8 O7 Sb . Na |
| Molecular Weight: | 336.88 |
| InChI: | InChI=1/C6H9O7.Na.Sb/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h2-5,10-11H,1H2,(H,12,13);;/q-3;+1;+3/p-1/rC6H9O7Sb.Na/c7-3(4(8)6(9)10)5-2-1-11-14(12-2)13-5;/h2-5,7-8H,1H2,(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Antimony(iii) sodium gluconate ,its CAS number is 12550-17-3,it can be called D-Gluconic acid, antimony complex ; Antimonate(l-), (D-gluconato(4-))-, sodium ; Gluconic acid, antimony sodium deriv ; Sodium antimony gluconate ; Trivalent sodium antimonyl gluconate . It is a toxic substance,with flammability, burning will produce toxic sodium oxide and antimony compound smoke,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened.
|
| Report: |
Antimony and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
