| Identification | |
| Name: | Mercury, (D-gluconato)-(9CI) |
| Synonyms: | D-Gluconicacid, mercury complex |
| CAS: | 63937-14-4 |
| Molecular Formula: | C6H11 Hg O7 |
| Molecular Weight: | 395.76 |
| InChI: | InChI=1/C6H12O7.Hg/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1637 |
| Flash Point: | 375.2°C |
| Boiling Point: | 673.6°C at 760 mmHg |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Flash Point: | 375.2°C |
| Safety Data | |
 |
|
