Identification |
Name: | Mercury, (D-gluconato)-(9CI) |
Synonyms: | D-Gluconicacid, mercury complex |
CAS: | 63937-14-4 |
Molecular Formula: | C6H11 Hg O7 |
Molecular Weight: | 395.76 |
InChI: | InChI=1/C6H12O7.Hg/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1 |
Molecular Structure: |
 |
Properties |
Transport: | 1637 |
Flash Point: | 375.2°C |
Boiling Point: | 673.6°C at 760 mmHg |
Report: |
Mercury and its compounds are on the Community Right-To-Know List.
|
Packinggroup: | II |
Flash Point: | 375.2°C |
Safety Data |
|
 |