| Identification |
| Name: | Benzoic acid,5-[[(2,5-dihydroxyphenyl)methyl]amino]-2-hydroxy- |
| Synonyms: | LavendustinC; NSC 666251 |
| CAS: | 125697-93-0 |
| Molecular Formula: | C14H13 N O5 |
| Molecular Weight: | 275.25672 |
| InChI: | InChI=1S/C14H13NO5/c16-10-2-4-12(17)8(5-10)7-15-9-1-3-13(18)11(6-9)14(19)20/h1-6,15-18H,7H2,(H,19,20) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.551 g/cm3 |
| Refractive index: | 1.758 |
| Water Solubility: | Soluble in DMSO and ethanol |
| Solubility: | Soluble in DMSO and ethanol |
| Appearance: | Yellow to tan powder |
| Storage Temperature: | −20°C |
| Usage: | Shows potent tyrosine kinase inhibitory activity |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
