| Identification | |
| Name: | 3-Bromo-1-chloro-5,5-dimethylhydantoin |
| Synonyms: | -3-bromo-1-chloro-5,5-dimethyl-4-imidazolidinedione; 3-bromo-1-chloro-5,5-dimethyl-hydantoi; 1-BROMO-3-CHLORO-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE; AGRIBROM; BROMO-CHLORO-5,5-DIMETHYLHYDANTOIN; HALOGENE(R); HALOBROM(R) |
| CAS: | 126-06-7 |
| EINECS: | 204-766-9 |
| Molecular Formula: | C5H6BrClN2O2 |
| Molecular Weight: | 241.47034 |
| InChI: | InChI=1S/C5H6BrClN2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3085 |
| Flash Point: | 232.7°Cat760mmHg |
| Boiling Point: | 232.7°Cat760mmHg |
| Density: | 1.91g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.61 |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble |
| Appearance: | white to off-white solid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 232.7°Cat760mmHg |
| Storage Temperature: | Keep container sealed. Cool in a cool, dry location. |
| Color: | Free-flowing white powder |
| Usage: | Germicide & fungicide in treatment of water, disinfectant, halogenating agent, catalyst of ionic type, selective oxidant. |
| Safety Data | |
| Hazard Symbols |
O:Oxidizingagent
C:Corrosive
|
 |
|
