| Identification | |
| Name: | 1-Bromo-3-chloro-5,5-dimethylhydantoin |
| Synonyms: | 1, 3-dibromo-5, 5-dimethyl hydantoin (DBDMH);2,4-Imidazolidinedione,1-bromo-3-chloro-5,- 5-dimethyl-;Hydantoin, 1-bromo-3-chloro-5,5-dimethyl-;N-Bromo-N-chloro-5,5-dimethylhydantoin;Halogene T 30;2,4-Imidazolidinedione, 1-bromo-3-chloro-5,5-dimethyl-;Slimicide C 77P;Agribrom;Bromine Disinfectant Tablet(BCDMH);Slimicide 78P; |
| CAS: | 16079-88-2 |
| EINECS: | 240-230-0 |
| Molecular Formula: | C5H6BrClN2O2 |
| Molecular Weight: | 241.47 |
| InChI: | InChI=1S/C5H6BrClN2O2/c1-5(2)3(10)8(7)4(11)9(5)6/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3085 |
| Melting Point: | 159 - 163 C (Decomposes) |
| Density: | 1.91g/cm3 |
| Stability: | Stable, but contact with combustible material may lead to fire. Incompatible with acids, organic materials, finely powdered metals. |
| Solubility: | Soluble in benzene, methylene dichloride, chloroform In water, 8.26X10+3 mg/L at 25 deg C (est) |
| Appearance: | white to off-white solid |
| Packinggroup: | II |
| Color: | Free-flowing, white powder |
| Safety Data | |
| Hazard Symbols |
O: Oxidizing agent
C: Corrosive
|
 |
|
