| Identification | |
| Name: | Piperidine,4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-methyl- |
| Synonyms: | 1-Methyl-4-(5H-dibenzo[a,d]cycloheptenylidene)piperidine;1-Methyl-4-(dibenzo[a,e]cycloheptatrien-5-ylidene)piperidine;4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-methylpiperidine; Cycloheptadine;Cyproheptadine; Periactinol |
| CAS: | 129-03-3 |
| EINECS: | 204-928-9 |
| Molecular Formula: | C21H21 N |
| Molecular Weight: | 287.43 |
| InChI: | InChI=1/C21H21N.ClH/c1-22-14-12-18(13-15-22)21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21;/h2-11H,12-15H2,1H3;1H |
| Molecular Structure: | ![(C21H21N) 1-Methyl-4-(5H-dibenzo[a,d]cycloheptenylidene)piperidine;1-Methyl-4-(dibenzo[a,e]cycloheptatrien-5-y...](https://img1.guidechem.com/chem/e/dict/193/129-03-3.jpg) |
| Properties | |
| Melting Point: | 116.5 - 118 |
| Flash Point: | 194.5°C |
| Boiling Point: | 440.1°Cat760mmHg |
| Density: | 1.115g/cm3 |
| Stability: | Relatively stable in light, stable @ room temperature. |
| Refractive index: | 1.5339 (20 C) |
| Solubility: | 5.5 g/L |
| Appearance: | Colorless liquid, sweet, almond odor. |
| Specification: |
The chemical synonyms of Cyproheptadine (CAS NO.129-03-3) are 1-Methyl-4-(5-dibenzo(a,e)cycloheptatrienylidene)piperidine ; 1-Methyl-4-(5H-dibenzo(a,d)cycloheptenylidene)piperidine ; 4-(5-Dibenzo(a,d)cyclohepten-5-ylidine)-1-methylpiperidine ; 4-(5H-Dibenzo(a,d)cyclohepten-5-ylidene)-1-methylpiperidene ; 4-(5H-Dibenzo(a,d)cyclohepten-5-ylidene)-1-methylpiperidine ; 5-(1-Methylpiperidylidene-4)-5H-dibenzo(a,d)cyclopheptene ; 5-20-08-00500 (Beilstein Handbook Reference) ; BRN 1685976 ; CCRIS 5232 ; Ciproheptadina ; Ciproheptadina [INN-Spanish] ; Cyproheptadine ; Cyproheptadinum ; Cyproheptadinum [INN-Latin] ; Dronactin ; EINECS 204-928-9 ; Eiproheptadine ; HSDB 3048 ; MK 141 ; Periactin ; Periactinol ; UNII-2YHB6175DO . |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | I; II; III |
| HS Code: | 29143900 |
| Flash Point: | 194.5°C |
| Storage Temperature: | Keep away from heat and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | CRYSTALS FROM DIL ETHANOL |
| Usage: | Medication. |
| Safety Data | |
 |
|
