| Identification | |
| Name: | 1-Propanamine,3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-, hydrochloride(1:1) |
| Synonyms: | 1-Propanamine,3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-, hydrochloride(9CI); 5H-Dibenzo[a,d]cycloheptene-D5,g-propylamine,10,11-dihydro-N-methyl-, hydrochloride (8CI);10,11-Dihydro-N-methyl-5H-dibenzo[a,d]cycloheptene-D5,g-propylamine hydrochloride; 38489; 5-(3-Methylaminopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cycloheptenehydrochloride; 5-[3-(Methylamino)propylidene]dibenzo[a,e]cyclohepta[1,5]dienehydrochloride; Acetexa; Allegron; Altilev; Aventyl hydrochloride;Desmethylamitriptyline hydrochloride; Noramitriptyline hydrochloride; Noritren;Nortrilen; Nortriptyline hydrochloride; Norzepine; Pamelor; Psychostyl;Sensival; Vividyl |
| CAS: | 894-71-3 |
| EINECS: | 212-973-0 |
| Molecular Formula: | C19H21 N . Cl H |
| Molecular Weight: | 299.84 |
| InChI: | InChI=1/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-11,20H,6,12-14H2,1H3;1H |
| Molecular Structure: | ![(C19H21N.ClH) 1-Propanamine,3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-, hydrochloride(9CI); ...](https://img1.guidechem.com/chem/e/dict/23/894-71-3.jpg) |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Melting Point: | 217-220?C |
| Flash Point: | 194.9°C |
| Boiling Point: | 403.4°C at 760 mmHg |
| Specification: | Off-White Solid usageEng:Tricyclic antidepressant. Safety Statements:22-36-45-24-16-7 22:Do not breathe dust 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24:Avoid contact with skin 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed |
| Flash Point: | 194.9°C |
| Storage Temperature: | 2-8°C |
| Color: | white to off-white |
| Usage: | Tricyclic antidepressant. |
| Safety Data | |
| Hazard Symbols | |
 |
|
