| Identification | |
| Name: | 1-Propanamine,3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl- |
| Synonyms: | 5H-Dibenzo[a,d]cycloheptene-D5,g-propylamine, 10,11-dihydro-N,N-dimethyl- (6CI,8CI);5-(3-Dimethylaminopropylidene)-5H-dibenzo[a,d]-10,11-dihydrocycloheptene;5-(3'-Dimethylaminopropylidene)-dibenzo-[a,d][1,4]-cycloheptadiene; 5-(g-Dimethylaminopropylidene)-10,11-dihydro-5H-dibenzo[a,d]cycloheptene;5-(g-Dimethylaminopropylidene)-5H-dibenzo(a,d)(1,4)cycloheptadiene;Adepress; Amitriprolidine; Amitriptylin; Amitriptyline; Damilen;Damitriptyline; Flavyl; MK 230; N 750; Proheptadiene; Seroten; Triptanol;Triptisol |
| CAS: | 50-48-6 |
| EINECS: | 200-041-6 |
| Molecular Formula: | C20H23 N |
| Molecular Weight: | 277.44 |
| InChI: | InChI=1/C20H23N.Na.H/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;;/h3-6,8-12H,7,13-15H2,1-2H3;;/rC20H23N.HNa/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-12H,7,13-15H2,1-2H3;1H |
| Molecular Structure: | ![(C20H23N) 5H-Dibenzo[a,d]cycloheptene-D5,g-propylamine, 10,11-dihydro-N,N-dimethyl- (6CI,8CI);5-(3-Dimethylami...](https://img1.guidechem.com/chem/e/dict/25/50-48-6.jpg) |
| Properties | |
| Melting Point: | 196-197 ºC |
| Flash Point: | 174°C |
| Boiling Point: | 398.2°Cat760mmHg |
| Density: | 1.076g/cm3 |
| Water Solubility: | 9.7 MG/ML |
| Solubility: | 9.7 mg/mL |
| Specification: |
Common side effects of using amitriptyline are mostly due to its anticholinergic activity, including: weight gain, dry mouth, loss of appetite, drowsiness, muscle stiffness, nausea, constipation, nervousness, dizziness, blurred vision, urinary retention and insomnia. Some rare side effects include tinnitus, hypotension, mania, psychosis, heart block, arrhythmias, lip and mouth ulcers, extrapyramidal symptoms, depression, and hepatic toxicity. |
| Flash Point: | 174°C |
| Color: | Minute crystals |
| Safety Data | |
 |
|
