| Identification | |
| Name: | 6-ALLYL-6,7-DIHYDRO-5H-DIBENZ(c,e)-AZEPINE PHOSPHATE |
| Synonyms: | 6-allyl-6,7-dihydro-5H-dibenz[c,e]azepinium dihydrogen phosphate |
| CAS: | 130-83-6 |
| EINECS: | 204-997-5 |
| Molecular Formula: | C17H17N . H3O4P |
| Molecular Weight: | 333.35 |
| InChI: | InChI=1/C17H17N.H3O4P/c1-2-11-18-12-14-7-3-5-9-16(14)17-10-6-4-8-15(17)13-18;1-5(2,3)4/h2-10H,1,11-13H2;(H3,1,2,3,4) |
| Molecular Structure: | ![(C17H17N.H3O4P) 6-allyl-6,7-dihydro-5H-dibenz[c,e]azepinium dihydrogen phosphate](https://img.guidechem.com/cas/gif/130-83-6.gif) |
| Properties | |
| Flash Point: | 157.1°C |
| Boiling Point: | 364.5°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6-Allyl-6,7-dihydro-5H-dibenz(c,e)-azepine phosphate (CAS NO.130-83-6) is also called 5H-Dibenz(c,e)azepine, 6,7-dihydro-6-allyl-, phosphate (1:1) ; 6,7-Dihydro-6-(2-propenyl)-5H-dibenz(c,e)azepine phosphate ; 6-Allyl-6,7-dihydro-5H-dibenz(c,e)azepin-dihydrogenphosphat ; Azapetine phosphate ; Azephine .6-Allyl-6,7-dihydro-5H-dibenz(c,e)-azepine phosphate (CAS NO.130-83-6) is high toxic. It is flammable. It will produce toxic nitrogen oxide and phosphorus oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep 6-Allyl-6,7-dihydro-5H-dibenz(c,e)-azepine phosphate (CAS NO.130-83-6) separate from raw materials of food. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 157.1°C |
| Safety Data | |
 |
|
