| Identification | |
| Name: | 5H-Dibenz[c,e]azepine,3,9-dichloro-6,7-dihydro-6-(2-propen-1-yl)- |
| Synonyms: | 5H-Dibenz[c,e]azepine,3,9-dichloro-6,7-dihydro-6-(2-propenyl)- (9CI) |
| CAS: | 63918-66-1 |
| Molecular Formula: | C17H15 Cl2 N |
| Molecular Weight: | 304.23 |
| InChI: | InChI=1/C17H15Cl2N/c1-2-7-20-10-12-8-14(18)3-5-16(12)17-6-4-15(19)9-13(17)11-20/h2-6,8-9H,1,7,10-11H2 |
| Molecular Structure: | ![(C17H15Cl2N) 5H-Dibenz[c,e]azepine,3,9-dichloro-6,7-dihydro-6-(2-propenyl)- (9CI)](https://img1.guidechem.com/chem/e/dict/16/63918-66-1.jpg) |
| Properties | |
| Flash Point: | 213.5°C |
| Boiling Point: | 429.4°Cat760mmHg |
| Density: | 1.226g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
6-Allyl-6,7-dihydro-3,9-dichloro-5H-dibenz(c,e)azepine , its cas register number is 64058-30-6. It also can be called 5H-Dibenz(c,e)azepine, 6,7-dihydro-6-allyl-3,9-dichloro- ; Ro 2-4106 . 6-Allyl-6,7-dihydro-3,9-dichloro-5H-dibenz(c,e)azepine (CAS NO.63918-66-1) is toxic and the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 213.5°C |
| Safety Data | |
 |
|
