| Identification | |
| Name: | Urea,N-(2-chloroethyl)-N'-cyclohexyl-N-nitroso- |
| Synonyms: | CeeNU;Chloroethylcyclohexylnitrosourea;CiNu;ICIG 1109;Lomustin;N-(2-Chloroethyl)-N'-cyclohexyl-N-nitrosourea;NCI C04740;NSC 79037;RB 1509;SRI 2200;Urea,1-(2-chloroethyl)-3-cyclohexyl-1-nitroso- (7CI,8CI);1-(2-Chloroethyl)-1-nitroso-3-cyclohexylurea;1-(2-Chloroethyl)-3-cyclohexylnitrosourea;Belustine;CCNU;Cecenu; |
| CAS: | 13010-47-4 |
| EINECS: | 235-859-2 |
| Molecular Formula: | C9H16ClN3O2 |
| Molecular Weight: | 233.69 |
| InChI: | InChI=1/C9H16ClN3O2/c10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h8H,1-7H2,(H,11,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Density: | 1.35 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.57 |
| Solubility: | practically insoluble |
| Appearance: | Yellow powder. |
| Packinggroup: | II |
| Color: | Solid Yellow powder |
| Usage: | Chloroethylnitrosourea derivative with antitumor activity. Similar to carmustine, chlorozotocin, nimustine, ranimustine. Antineoplastic. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
