| Identification | |
| Name: | Urea,N,N,N'-tris(2-chloroethyl)-N'-nitroso- |
| Synonyms: | Urea,tris(2-chloroethyl)nitroso- (9CI) |
| CAS: | 69113-01-5 |
| Molecular Formula: | C7H12 Cl3 N3 O2 |
| Molecular Weight: | 276.57 |
| InChI: | InChI=1/C7H12Cl3N3O2/c8-1-4-12(5-2-9)7(14)13(11-15)6-3-10/h1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.8°C |
| Boiling Point: | 345.6°C at 760 mmHg |
| Density: | 1.42g/cm3 |
| Refractive index: | 1.543 |
| Specification: |
Nitrosotris(chloroethyl)urea , its cas register number is 69113-01-5. It also can be called Urea, 1-nitroso-1,3,3-tris(2-chloroethyl)- ; 1-Nitroso-1,3,3-tris-(2-chloroethyl)urea ; and 3-Nitroso-1,1,3-tris(chloroethyl)urea . |
| Flash Point: | 162.8°C |
| Safety Data | |
 |
|
