| Identification |
| Name: | Urea,N,N,N'-tris(2-chloroethyl)- |
| Synonyms: | Urea,tris(2-chloroethyl)- (9CI); 1,3,3-Tris(2-chloroethyl)urea |
| CAS: | 71162-64-6 |
| Molecular Formula: | C7H13 Cl3 N2 O |
| Molecular Weight: | 247.55 |
| InChI: | InChI=1/C7H13Cl3N2O/c8-1-4-11-7(13)12(5-2-9)6-3-10/h1-6H2,(H,11,13) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 203.9°C |
| Boiling Point: | 413.5°C at 760 mmHg |
| Density: | 1.293g/cm3 |
| Refractive index: | 1.5 |
| Flash Point: | 203.9°C |
| Usage: | Chlorinated derivatives of nitrosotrialkylureas; carcinogenic, inducing tumors of the nonglandular stomach and of the lungs. |
| Safety Data |
| |
 |
