| Identification |
| Name: | 1,2-Benzenediamine,4,5-dimethoxy-, hydrochloride (1:2) |
| Synonyms: | 1,2-Benzenediamine,4,5-dimethoxy-, dihydrochloride (9CI); 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride;4,5-Dimethoxybenzene-1,2-diamine dihydrochloride |
| CAS: | 131076-14-7 |
| EINECS: | -0 |
| Molecular Formula: | C8H12 N2 O2 . 2 Cl H |
| Molecular Weight: | 241.11 |
| InChI: | InChI=1/C8H12N2O2.2ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;;/h3-4H,9-10H2,1-2H3;2*1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Melting Point: | 266-268°C |
| Flash Point: | 187.1°C |
| Boiling Point: | 385.7°Cat760mmHg |
| Density: | g/cm3 |
| Packinggroup: | III |
| Flash Point: | 187.1°C |
| Usage: | Reacts with aldehydes to produce highly fluorescent benzimidazole derivatives. Can be used for the detection of aromatic aldehydes as well as DTAN |
| Safety Data |
| |
 |
