| Identification | |
| Name: | Antimony pentasulfide |
| Synonyms: | Antimony sulfide (Sb2S5);Antimony Red;Diantimony pentasulphide;Antimony sulfide golden;Antimony sulfide;Antimonial saffron;Golden antimony sulfide;Antimonic sulfide;C.I. 77061; |
| CAS: | 1315-04-4 |
| EINECS: | 215-255-5 |
| Molecular Formula: | S5Sb2 |
| Molecular Weight: | 403.8 |
| InChI: | InChI=1/5S.2Sb/rS5Sb2/c1-6(2)5-7(3)4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3178 4.1/PG 2 |
| Melting Point: | 74-76°C (dec.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | orange powder |
| Specification: |
Antimony pentasulfide (CAS NO.1315-04-4) is moderate toxic. It may explosive with strong oxidants spontaneously if vibrated. Antimony pentasulfide (CAS NO.1315-04-4) will burn by the presence of open flame, high temperature and oxidizer. It will produce toxic sulfur oxides and antimony compounds smoke when buring. It also will decomposit toxic gases of nitrogen oxides in the wet environment. |
| Report: |
Reported in EPA TSCA Inventory. Antimony and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
Flammable, dangerous fire risk near oxidizing materials. TLV: 0.5
|
 |
|
